C24H35FN4O5S — CID 44556084
N-(cyclohexylmethoxy)-6-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]-N-(2-fluoroethyl)hexane-1-sulfonamide (PubChem CID 44556084) has the molecular formula C24H35FN4O5S and a molecular weight of 510.63 g/mol. Its IUPAC name is N-(cyclohexylmethoxy)-6-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]-N-(2-fluoroethyl)hexane-1-sulfonamide.
| Compound Name | N-(cyclohexylmethoxy)-6-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]-N-(2-fluoroethyl)hexane-1-sulfonamide |
|---|---|
| PubChem CID | 44556084 |
| Molecular Formula | C24H35FN4O5S |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | N-(cyclohexylmethoxy)-6-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]-N-(2-fluoroethyl)hexane-1-sulfonamide |
| SMILES | O=c1c(NCCCCCCS(=O)(=O)N(CCF)OCC2CCCCC2)c(Nc2ccncc2)c1=O |
| InChI | InChI=1S/C24H35FN4O5S/c25-12-16-29(34-18-19-8-4-3-5-9-19)35(32,33)17-7-2-1-6-13-27-21-22(24(31)23(21)30)28-20-10-14-26-15-11-20/h10-11,14-15,19,27H,1-9,12-13,16-18H2,(H,26,28) |
| InChIKey | IEBILNGCKCSYFI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|