C21H35FN4O3S2 — CID 46183636
1-[6-[cyclohexylmethoxy(2-fluoroethyl)sulfamoyl]hexyl]-3-pyridin-4-ylthiourea (PubChem CID 46183636) has the molecular formula C21H35FN4O3S2 and a molecular weight of 474.67 g/mol. Its IUPAC name is 1-[6-[cyclohexylmethoxy(2-fluoroethyl)sulfamoyl]hexyl]-3-pyridin-4-ylthiourea.
| Compound Name | 1-[6-[cyclohexylmethoxy(2-fluoroethyl)sulfamoyl]hexyl]-3-pyridin-4-ylthiourea |
|---|---|
| PubChem CID | 46183636 |
| Molecular Formula | C21H35FN4O3S2 |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 1-[6-[cyclohexylmethoxy(2-fluoroethyl)sulfamoyl]hexyl]-3-pyridin-4-ylthiourea |
| SMILES | O=S(=O)(CCCCCCNC(=S)Nc1ccncc1)N(CCF)OCC1CCCCC1 |
| InChI | InChI=1S/C21H35FN4O3S2/c22-12-16-26(29-18-19-8-4-3-5-9-19)31(27,28)17-7-2-1-6-13-24-21(30)25-20-10-14-23-15-11-20/h10-11,14-15,19H,1-9,12-13,16-18H2,(H2,23,24,25,30) |
| InChIKey | XFQCAGFTKZDBBO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|