C24H37N5O3S — CID 89004087
2-[8-[phenylmethoxy(propan-2-ylsulfonyl)amino]octyl]-1-pyridin-4-ylguanidine (PubChem CID 89004087) has the molecular formula C24H37N5O3S and a molecular weight of 475.66 g/mol. Its IUPAC name is 2-[8-[phenylmethoxy(propan-2-ylsulfonyl)amino]octyl]-1-pyridin-4-ylguanidine.
| Compound Name | 2-[8-[phenylmethoxy(propan-2-ylsulfonyl)amino]octyl]-1-pyridin-4-ylguanidine |
|---|---|
| PubChem CID | 89004087 |
| Molecular Formula | C24H37N5O3S |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | 2-[8-[phenylmethoxy(propan-2-ylsulfonyl)amino]octyl]-1-pyridin-4-ylguanidine |
| SMILES | CC(C)S(=O)(=O)N(CCCCCCCC/N=C(\N)Nc1ccncc1)OCc1ccccc1 |
| InChI | InChI=1S/C24H37N5O3S/c1-21(2)33(30,31)29(32-20-22-12-8-7-9-13-22)19-11-6-4-3-5-10-16-27-24(25)28-23-14-17-26-18-15-23/h7-9,12-15,17-18,21H,3-6,10-11,16,19-20H2,1-2H3,(H3,25,26,27,28) |
| InChIKey | ZXRJCIYIACKUMY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 109.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|