C21H28IN3O2 — CID 110028921
benzyl 5-[[amino-(3-ethylanilino)methylidene]amino]pentanoate;hydroiodide (PubChem CID 110028921) has the molecular formula C21H28IN3O2 and a molecular weight of 481.38 g/mol. Its IUPAC name is benzyl 5-[[amino-(3-ethylanilino)methylidene]amino]pentanoate;hydroiodide.
| Compound Name | benzyl 5-[[amino-(3-ethylanilino)methylidene]amino]pentanoate;hydroiodide |
|---|---|
| PubChem CID | 110028921 |
| Molecular Formula | C21H28IN3O2 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | benzyl 5-[[amino-(3-ethylanilino)methylidene]amino]pentanoate;hydroiodide |
| SMILES | CCc1cccc(N/C(N)=N/CCCCC(=O)OCc2ccccc2)c1.I |
| InChI | InChI=1S/C21H27N3O2.HI/c1-2-17-11-8-12-19(15-17)24-21(22)23-14-7-6-13-20(25)26-16-18-9-4-3-5-10-18;/h3-5,8-12,15H,2,6-7,13-14,16H2,1H3,(H3,22,23,24);1H |
| InChIKey | DNXYTNMFBSBBSB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|