C25H24N6O3S — CID 90013036
1-cyano-2-[[4-[3-(morpholine-4-carbonyl)phenyl]sulfinylphenyl]methyl]-3-pyridin-4-ylguanidine (PubChem CID 90013036) has the molecular formula C25H24N6O3S and a molecular weight of 488.57 g/mol. Its IUPAC name is 1-cyano-2-[[4-[3-(morpholine-4-carbonyl)phenyl]sulfinylphenyl]methyl]-3-pyridin-4-ylguanidine.
| Compound Name | 1-cyano-2-[[4-[3-(morpholine-4-carbonyl)phenyl]sulfinylphenyl]methyl]-3-pyridin-4-ylguanidine |
|---|---|
| PubChem CID | 90013036 |
| Molecular Formula | C25H24N6O3S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 1-cyano-2-[[4-[3-(morpholine-4-carbonyl)phenyl]sulfinylphenyl]methyl]-3-pyridin-4-ylguanidine |
| SMILES | N#CN/C(=N\Cc1ccc(S(=O)c2cccc(C(=O)N3CCOCC3)c2)cc1)Nc1ccncc1 |
| InChI | InChI=1S/C25H24N6O3S/c26-18-29-25(30-21-8-10-27-11-9-21)28-17-19-4-6-22(7-5-19)35(33)23-3-1-2-20(16-23)24(32)31-12-14-34-15-13-31/h1-11,16H,12-15,17H2,(H2,27,28,29,30) |
| InChIKey | HUTTYNAMACJFCX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 119.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|