C22H27N5O3S — CID 140789693
1-cyano-2-[[4-(4-ethoxycyclohexyl)sulfonylphenyl]methyl]-3-pyridin-4-ylguanidine (PubChem CID 140789693) has the molecular formula C22H27N5O3S and a molecular weight of 441.56 g/mol. Its IUPAC name is 1-cyano-2-[[4-(4-ethoxycyclohexyl)sulfonylphenyl]methyl]-3-pyridin-4-ylguanidine.
| Compound Name | 1-cyano-2-[[4-(4-ethoxycyclohexyl)sulfonylphenyl]methyl]-3-pyridin-4-ylguanidine |
|---|---|
| PubChem CID | 140789693 |
| Molecular Formula | C22H27N5O3S |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 1-cyano-2-[[4-(4-ethoxycyclohexyl)sulfonylphenyl]methyl]-3-pyridin-4-ylguanidine |
| SMILES | CCOC1CCC(S(=O)(=O)c2ccc(C/N=C(\NC#N)Nc3ccncc3)cc2)CC1 |
| InChI | InChI=1S/C22H27N5O3S/c1-2-30-19-5-9-21(10-6-19)31(28,29)20-7-3-17(4-8-20)15-25-22(26-16-23)27-18-11-13-24-14-12-18/h3-4,7-8,11-14,19,21H,2,5-6,9-10,15H2,1H3,(H2,24,25,26,27) |
| InChIKey | IRPMFWSLIMIJFY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 116.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|