C22H18F3N5O3S — CID 56929538
1-cyano-2-[[4-[2-methoxy-4-(trifluoromethyl)phenyl]sulfonylphenyl]methyl]-3-pyridin-4-ylguanidine (PubChem CID 56929538) has the molecular formula C22H18F3N5O3S and a molecular weight of 489.48 g/mol. Its IUPAC name is 1-cyano-2-[[4-[2-methoxy-4-(trifluoromethyl)phenyl]sulfonylphenyl]methyl]-3-pyridin-4-ylguanidine.
| Compound Name | 1-cyano-2-[[4-[2-methoxy-4-(trifluoromethyl)phenyl]sulfonylphenyl]methyl]-3-pyridin-4-ylguanidine |
|---|---|
| PubChem CID | 56929538 |
| Molecular Formula | C22H18F3N5O3S |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 1-cyano-2-[[4-[2-methoxy-4-(trifluoromethyl)phenyl]sulfonylphenyl]methyl]-3-pyridin-4-ylguanidine |
| SMILES | COc1cc(C(F)(F)F)ccc1S(=O)(=O)c1ccc(C/N=C(\NC#N)Nc2ccncc2)cc1 |
| InChI | InChI=1S/C22H18F3N5O3S/c1-33-19-12-16(22(23,24)25)4-7-20(19)34(31,32)18-5-2-15(3-6-18)13-28-21(29-14-26)30-17-8-10-27-11-9-17/h2-12H,13H2,1H3,(H2,27,28,29,30) |
| InChIKey | BASGAESGHAHVMP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 116.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|