C23H24N6O4S2 — CID 56928678
1-cyano-2-[[4-[3-(propylsulfonylamino)phenyl]sulfonylphenyl]methyl]-3-pyridin-4-ylguanidine (PubChem CID 56928678) has the molecular formula C23H24N6O4S2 and a molecular weight of 512.62 g/mol. Its IUPAC name is 1-cyano-2-[[4-[3-(propylsulfonylamino)phenyl]sulfonylphenyl]methyl]-3-pyridin-4-ylguanidine.
| Compound Name | 1-cyano-2-[[4-[3-(propylsulfonylamino)phenyl]sulfonylphenyl]methyl]-3-pyridin-4-ylguanidine |
|---|---|
| PubChem CID | 56928678 |
| Molecular Formula | C23H24N6O4S2 |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | 1-cyano-2-[[4-[3-(propylsulfonylamino)phenyl]sulfonylphenyl]methyl]-3-pyridin-4-ylguanidine |
| SMILES | CCCS(=O)(=O)Nc1cccc(S(=O)(=O)c2ccc(C/N=C(\NC#N)Nc3ccncc3)cc2)c1 |
| InChI | InChI=1S/C23H24N6O4S2/c1-2-14-34(30,31)29-20-4-3-5-22(15-20)35(32,33)21-8-6-18(7-9-21)16-26-23(27-17-24)28-19-10-12-25-13-11-19/h3-13,15,29H,2,14,16H2,1H3,(H2,25,26,27,28) |
| InChIKey | XADXLSXNCYCDPK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 153.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|