C21H15ClF3N5O2S — CID 56929164
2-[[4-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylphenyl]methyl]-1-cyano-3-pyridin-4-ylguanidine (PubChem CID 56929164) has the molecular formula C21H15ClF3N5O2S and a molecular weight of 493.90 g/mol. Its IUPAC name is 2-[[4-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylphenyl]methyl]-1-cyano-3-pyridin-4-ylguanidine.
| Compound Name | 2-[[4-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylphenyl]methyl]-1-cyano-3-pyridin-4-ylguanidine |
|---|---|
| PubChem CID | 56929164 |
| Molecular Formula | C21H15ClF3N5O2S |
| Molecular Weight | 493.90 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | 2-[[4-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylphenyl]methyl]-1-cyano-3-pyridin-4-ylguanidine |
| SMILES | N#CN/C(=N\Cc1ccc(S(=O)(=O)c2ccc(Cl)c(C(F)(F)F)c2)cc1)Nc1ccncc1 |
| InChI | InChI=1S/C21H15ClF3N5O2S/c22-19-6-5-17(11-18(19)21(23,24)25)33(31,32)16-3-1-14(2-4-16)12-28-20(29-13-26)30-15-7-9-27-10-8-15/h1-11H,12H2,(H2,27,28,29,30) |
| InChIKey | ZZTCDBQNNWUUEG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 107.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.90 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|