C22H24N4O2S — CID 129213956
2-[[4-(4-propan-2-ylphenyl)sulfonylphenyl]methyl]-1-pyridin-4-ylguanidine (PubChem CID 129213956) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is 2-[[4-(4-propan-2-ylphenyl)sulfonylphenyl]methyl]-1-pyridin-4-ylguanidine.
| Compound Name | 2-[[4-(4-propan-2-ylphenyl)sulfonylphenyl]methyl]-1-pyridin-4-ylguanidine |
|---|---|
| PubChem CID | 129213956 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 2-[[4-(4-propan-2-ylphenyl)sulfonylphenyl]methyl]-1-pyridin-4-ylguanidine |
| SMILES | CC(C)c1ccc(S(=O)(=O)c2ccc(C/N=C(\N)Nc3ccncc3)cc2)cc1 |
| InChI | InChI=1S/C22H24N4O2S/c1-16(2)18-5-9-21(10-6-18)29(27,28)20-7-3-17(4-8-20)15-25-22(23)26-19-11-13-24-14-12-19/h3-14,16H,15H2,1-2H3,(H3,23,24,25,26) |
| InChIKey | SWTLWNCUDYWCQL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|