C20H25ClN4O2S — CID 140620278
2-[[4-(3-chloro-4-methylcyclohexyl)sulfonylphenyl]methyl]-1-pyridin-4-ylguanidine (PubChem CID 140620278) has the molecular formula C20H25ClN4O2S and a molecular weight of 420.97 g/mol. Its IUPAC name is 2-[[4-(3-chloro-4-methylcyclohexyl)sulfonylphenyl]methyl]-1-pyridin-4-ylguanidine.
| Compound Name | 2-[[4-(3-chloro-4-methylcyclohexyl)sulfonylphenyl]methyl]-1-pyridin-4-ylguanidine |
|---|---|
| PubChem CID | 140620278 |
| Molecular Formula | C20H25ClN4O2S |
| Molecular Weight | 420.97 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 2-[[4-(3-chloro-4-methylcyclohexyl)sulfonylphenyl]methyl]-1-pyridin-4-ylguanidine |
| SMILES | CC1CCC(S(=O)(=O)c2ccc(C/N=C(\N)Nc3ccncc3)cc2)CC1Cl |
| InChI | InChI=1S/C20H25ClN4O2S/c1-14-2-5-18(12-19(14)21)28(26,27)17-6-3-15(4-7-17)13-24-20(22)25-16-8-10-23-11-9-16/h3-4,6-11,14,18-19H,2,5,12-13H2,1H3,(H3,22,23,24,25) |
| InChIKey | CICFGXCMOGZZQK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.97 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|