C29H28N2O5S2 — CID 175922236
1,3-bis[3-(4-ethylphenyl)sulfonylphenyl]urea (PubChem CID 175922236) has the molecular formula C29H28N2O5S2 and a molecular weight of 548.69 g/mol. Its IUPAC name is 1,3-bis[3-(4-ethylphenyl)sulfonylphenyl]urea.
| Compound Name | 1,3-bis[3-(4-ethylphenyl)sulfonylphenyl]urea |
|---|---|
| PubChem CID | 175922236 |
| Molecular Formula | C29H28N2O5S2 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | 1,3-bis[3-(4-ethylphenyl)sulfonylphenyl]urea |
| SMILES | CCc1ccc(S(=O)(=O)c2cccc(NC(=O)Nc3cccc(S(=O)(=O)c4ccc(CC)cc4)c3)c2)cc1 |
| InChI | InChI=1S/C29H28N2O5S2/c1-3-21-11-15-25(16-12-21)37(33,34)27-9-5-7-23(19-27)30-29(32)31-24-8-6-10-28(20-24)38(35,36)26-17-13-22(4-2)14-18-26/h5-20H,3-4H2,1-2H3,(H2,30,31,32) |
| InChIKey | GHUDXPKICQGWCP-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |