C25H21N3O4S — CID 167752958
1-[3-(benzenesulfonyl)phenyl]-3-[(2-naphthalen-2-ylacetyl)amino]urea (PubChem CID 167752958) has the molecular formula C25H21N3O4S and a molecular weight of 459.53 g/mol. Its IUPAC name is 1-[3-(benzenesulfonyl)phenyl]-3-[(2-naphthalen-2-ylacetyl)amino]urea.
| Compound Name | 1-[3-(benzenesulfonyl)phenyl]-3-[(2-naphthalen-2-ylacetyl)amino]urea |
|---|---|
| PubChem CID | 167752958 |
| Molecular Formula | C25H21N3O4S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 1-[3-(benzenesulfonyl)phenyl]-3-[(2-naphthalen-2-ylacetyl)amino]urea |
| SMILES | O=C(Cc1ccc2ccccc2c1)NNC(=O)Nc1cccc(S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C25H21N3O4S/c29-24(16-18-13-14-19-7-4-5-8-20(19)15-18)27-28-25(30)26-21-9-6-12-23(17-21)33(31,32)22-10-2-1-3-11-22/h1-15,17H,16H2,(H,27,29)(H2,26,28,30) |
| InChIKey | MWQTWLUNOYVGTH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|