C26H24N4O4S — CID 54539781
1-methyl-3-[3-[3-[(6-methylnaphthalen-2-yl)carbamoylamino]phenyl]sulfonylphenyl]urea (PubChem CID 54539781) has the molecular formula C26H24N4O4S and a molecular weight of 488.57 g/mol. Its IUPAC name is 1-methyl-3-[3-[3-[(6-methylnaphthalen-2-yl)carbamoylamino]phenyl]sulfonylphenyl]urea.
| Compound Name | 1-methyl-3-[3-[3-[(6-methylnaphthalen-2-yl)carbamoylamino]phenyl]sulfonylphenyl]urea |
|---|---|
| PubChem CID | 54539781 |
| Molecular Formula | C26H24N4O4S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 1-methyl-3-[3-[3-[(6-methylnaphthalen-2-yl)carbamoylamino]phenyl]sulfonylphenyl]urea |
| SMILES | CNC(=O)Nc1cccc(S(=O)(=O)c2cccc(NC(=O)Nc3ccc4cc(C)ccc4c3)c2)c1 |
| InChI | InChI=1S/C26H24N4O4S/c1-17-9-10-19-14-22(12-11-18(19)13-17)30-26(32)29-21-6-4-8-24(16-21)35(33,34)23-7-3-5-20(15-23)28-25(31)27-2/h3-16H,1-2H3,(H2,27,28,31)(H2,29,30,32) |
| InChIKey | ZCIGSJPZXYYBPN-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |