C9H10F3O7PS — CID 174263476
[2-methoxy-4-(trifluoromethyl)phenyl]sulfonyloxymethylphosphonic acid (PubChem CID 174263476) has the molecular formula C9H10F3O7PS and a molecular weight of 350.21 g/mol. Its IUPAC name is [2-methoxy-4-(trifluoromethyl)phenyl]sulfonyloxymethylphosphonic acid.
| Compound Name | [2-methoxy-4-(trifluoromethyl)phenyl]sulfonyloxymethylphosphonic acid |
|---|---|
| PubChem CID | 174263476 |
| Molecular Formula | C9H10F3O7PS |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | [2-methoxy-4-(trifluoromethyl)phenyl]sulfonyloxymethylphosphonic acid |
| SMILES | COc1cc(C(F)(F)F)ccc1S(=O)(=O)OCP(=O)(O)O |
| InChI | InChI=1S/C9H10F3O7PS/c1-18-7-4-6(9(10,11)12)2-3-8(7)21(16,17)19-5-20(13,14)15/h2-4H,5H2,1H3,(H2,13,14,15) |
| InChIKey | QYQLUUOBLJJWNU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|