C13H14F3O5S- — CID 59503128
2-(2,2-dimethylbutanoyloxy)-4-(trifluoromethyl)benzenesulfonate (PubChem CID 59503128) has the molecular formula C13H14F3O5S- and a molecular weight of 339.31 g/mol. Its IUPAC name is 2-(2,2-dimethylbutanoyloxy)-4-(trifluoromethyl)benzenesulfonate.
| Compound Name | 2-(2,2-dimethylbutanoyloxy)-4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 59503128 |
| Molecular Formula | C13H14F3O5S- |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 2-(2,2-dimethylbutanoyloxy)-4-(trifluoromethyl)benzenesulfonate |
| SMILES | CCC(C)(C)C(=O)Oc1cc(C(F)(F)F)ccc1S(=O)(=O)[O-] |
| InChI | InChI=1S/C13H15F3O5S/c1-4-12(2,3)11(17)21-9-7-8(13(14,15)16)5-6-10(9)22(18,19)20/h5-7H,4H2,1-3H3,(H,18,19,20)/p-1 |
| InChIKey | VOKQVSHDJZEAAO-UHFFFAOYSA-M |
| XLogP | 2.95 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|