C22H30N4O4S — CID 56536813
3-(ethylsulfamoyl)-N-(3-morpholin-4-ylpropyl)-N-(pyridin-4-ylmethyl)benzamide (PubChem CID 56536813) has the molecular formula C22H30N4O4S and a molecular weight of 446.57 g/mol. Its IUPAC name is 3-(ethylsulfamoyl)-N-(3-morpholin-4-ylpropyl)-N-(pyridin-4-ylmethyl)benzamide.
| Compound Name | 3-(ethylsulfamoyl)-N-(3-morpholin-4-ylpropyl)-N-(pyridin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 56536813 |
| Molecular Formula | C22H30N4O4S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 3-(ethylsulfamoyl)-N-(3-morpholin-4-ylpropyl)-N-(pyridin-4-ylmethyl)benzamide |
| SMILES | CCNS(=O)(=O)c1cccc(C(=O)N(CCCN2CCOCC2)Cc2ccncc2)c1 |
| InChI | InChI=1S/C22H30N4O4S/c1-2-24-31(28,29)21-6-3-5-20(17-21)22(27)26(18-19-7-9-23-10-8-19)12-4-11-25-13-15-30-16-14-25/h3,5-10,17,24H,2,4,11-16,18H2,1H3 |
| InChIKey | CYLKDEUMMHGGAV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |