C25H29N3O3S — CID 170563676
3-[2-(aziridin-1-yl)ethylsulfamoyl]-N-(naphthalen-2-ylmethyl)-N-propylbenzamide (PubChem CID 170563676) has the molecular formula C25H29N3O3S and a molecular weight of 451.59 g/mol. Its IUPAC name is 3-[2-(aziridin-1-yl)ethylsulfamoyl]-N-(naphthalen-2-ylmethyl)-N-propylbenzamide.
| Compound Name | 3-[2-(aziridin-1-yl)ethylsulfamoyl]-N-(naphthalen-2-ylmethyl)-N-propylbenzamide |
|---|---|
| PubChem CID | 170563676 |
| Molecular Formula | C25H29N3O3S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 3-[2-(aziridin-1-yl)ethylsulfamoyl]-N-(naphthalen-2-ylmethyl)-N-propylbenzamide |
| SMILES | CCCN(Cc1ccc2ccccc2c1)C(=O)c1cccc(S(=O)(=O)NCCN2CC2)c1 |
| InChI | InChI=1S/C25H29N3O3S/c1-2-13-28(19-20-10-11-21-6-3-4-7-22(21)17-20)25(29)23-8-5-9-24(18-23)32(30,31)26-12-14-27-15-16-27/h3-11,17-18,26H,2,12-16,19H2,1H3 |
| InChIKey | CYDMQFCCILCIJS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 69.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|