C17H26ClN3O3S — CID 170563665
3-[2-(aziridin-1-yl)ethylsulfamoyl]-4-chloro-N,N-dipropylbenzamide (PubChem CID 170563665) has the molecular formula C17H26ClN3O3S and a molecular weight of 387.93 g/mol. Its IUPAC name is 3-[2-(aziridin-1-yl)ethylsulfamoyl]-4-chloro-N,N-dipropylbenzamide.
| Compound Name | 3-[2-(aziridin-1-yl)ethylsulfamoyl]-4-chloro-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 170563665 |
| Molecular Formula | C17H26ClN3O3S |
| Molecular Weight | 387.93 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 3-[2-(aziridin-1-yl)ethylsulfamoyl]-4-chloro-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1ccc(Cl)c(S(=O)(=O)NCCN2CC2)c1 |
| InChI | InChI=1S/C17H26ClN3O3S/c1-3-8-21(9-4-2)17(22)14-5-6-15(18)16(13-14)25(23,24)19-7-10-20-11-12-20/h5-6,13,19H,3-4,7-12H2,1-2H3 |
| InChIKey | GEWRTHLYJLSWGW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 69.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.93 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|