C17H28N4O4S — CID 109063961
3-[2-(dimethylamino)ethylsulfamoyl]-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 109063961) has the molecular formula C17H28N4O4S and a molecular weight of 384.50 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethylsulfamoyl]-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | 3-[2-(dimethylamino)ethylsulfamoyl]-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 109063961 |
| Molecular Formula | C17H28N4O4S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 3-[2-(dimethylamino)ethylsulfamoyl]-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | CN(C)CCNS(=O)(=O)c1cccc(C(=O)NCCN2CCOCC2)c1 |
| InChI | InChI=1S/C17H28N4O4S/c1-20(2)8-7-19-26(23,24)16-5-3-4-15(14-16)17(22)18-6-9-21-10-12-25-13-11-21/h3-5,14,19H,6-13H2,1-2H3,(H,18,22) |
| InChIKey | AZQIYDYMTBCKHD-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |