C24H28N6O — CID 134227263
2-[(E)-5-(1-benzoylpiperidin-4-yl)pent-2-enyl]-1-cyano-3-pyridin-4-ylguanidine (PubChem CID 134227263) has the molecular formula C24H28N6O and a molecular weight of 416.53 g/mol. Its IUPAC name is 2-[(E)-5-(1-benzoylpiperidin-4-yl)pent-2-enyl]-1-cyano-3-pyridin-4-ylguanidine.
| Compound Name | 2-[(E)-5-(1-benzoylpiperidin-4-yl)pent-2-enyl]-1-cyano-3-pyridin-4-ylguanidine |
|---|---|
| PubChem CID | 134227263 |
| Molecular Formula | C24H28N6O |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 2-[(E)-5-(1-benzoylpiperidin-4-yl)pent-2-enyl]-1-cyano-3-pyridin-4-ylguanidine |
| SMILES | N#CN/C(=N\C/C=C/CCC1CCN(C(=O)c2ccccc2)CC1)Nc1ccncc1 |
| InChI | InChI=1S/C24H28N6O/c25-19-28-24(29-22-10-15-26-16-11-22)27-14-6-2-3-7-20-12-17-30(18-13-20)23(31)21-8-4-1-5-9-21/h1-2,4-6,8-11,15-16,20H,3,7,12-14,17-18H2,(H2,26,27,28,29)/b6-2+ |
| InChIKey | XUVPZLPRJFHWRG-QHHAFSJGSA-N |
| XLogP | 3.81 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|