C22H26F2N6OS — CID 168813732
1-cyano-3-(2,6-difluoro-4-pyridinyl)-2-[6-[1-(thiophene-2-carbonyl)pyrrolidin-3-yl]hexyl]guanidine (PubChem CID 168813732) has the molecular formula C22H26F2N6OS and a molecular weight of 460.55 g/mol. Its IUPAC name is 1-cyano-3-(2,6-difluoro-4-pyridinyl)-2-[6-[1-(thiophene-2-carbonyl)pyrrolidin-3-yl]hexyl]guanidine.
| Compound Name | 1-cyano-3-(2,6-difluoro-4-pyridinyl)-2-[6-[1-(thiophene-2-carbonyl)pyrrolidin-3-yl]hexyl]guanidine |
|---|---|
| PubChem CID | 168813732 |
| Molecular Formula | C22H26F2N6OS |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 1-cyano-3-(2,6-difluoro-4-pyridinyl)-2-[6-[1-(thiophene-2-carbonyl)pyrrolidin-3-yl]hexyl]guanidine |
| SMILES | N#CN/C(=N\CCCCCCC1CCN(C(=O)c2cccs2)C1)Nc1cc(F)nc(F)c1 |
| InChI | InChI=1S/C22H26F2N6OS/c23-19-12-17(13-20(24)29-19)28-22(27-15-25)26-9-4-2-1-3-6-16-8-10-30(14-16)21(31)18-7-5-11-32-18/h5,7,11-13,16H,1-4,6,8-10,14H2,(H2,26,27,28,29) |
| InChIKey | AILFSJHZKAICFS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|