C21H27NO4S2 — CID 168813872
5-[1-(thiophene-2-carbonyl)pyrrolidin-3-yl]pentyl 4-methylbenzenesulfonate (PubChem CID 168813872) has the molecular formula C21H27NO4S2 and a molecular weight of 421.58 g/mol. Its IUPAC name is 5-[1-(thiophene-2-carbonyl)pyrrolidin-3-yl]pentyl 4-methylbenzenesulfonate.
| Compound Name | 5-[1-(thiophene-2-carbonyl)pyrrolidin-3-yl]pentyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 168813872 |
| Molecular Formula | C21H27NO4S2 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 5-[1-(thiophene-2-carbonyl)pyrrolidin-3-yl]pentyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCCC2CCN(C(=O)c3cccs3)C2)cc1 |
| InChI | InChI=1S/C21H27NO4S2/c1-17-8-10-19(11-9-17)28(24,25)26-14-4-2-3-6-18-12-13-22(16-18)21(23)20-7-5-15-27-20/h5,7-11,15,18H,2-4,6,12-14,16H2,1H3 |
| InChIKey | RSQAFYFMUAGEFJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|