About (2E)-1-(5,7-dimethyl-1-benzofuran-2-yl)-2-ethenylpenta-2,4-dien-1-ol;ethane
(2E)-1-(5,7-dimethyl-1-benzofuran-2-yl)-2-ethenylpenta-2,4-dien-1-ol;ethane (PubChem CID 156724796) has the molecular formula C21H30O2
and a molecular weight of 314.47 g/mol. Its IUPAC name is (2E)-1-(5,7-dimethyl-1-benzofuran-2-yl)-2-ethenylpenta-2,4-dien-1-ol;ethane.
Molecular Properties
| Compound Name | (2E)-1-(5,7-dimethyl-1-benzofuran-2-yl)-2-ethenylpenta-2,4-dien-1-ol;ethane |
| PubChem CID | 156724796 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (2E)-1-(5,7-dimethyl-1-benzofuran-2-yl)-2-ethenylpenta-2,4-dien-1-ol;ethane |
| SMILES | C=C/C=C(\C=C)C(O)c1cc2cc(C)cc(C)c2o1.CC.CC |
| InChI | InChI=1S/C17H18O2.2C2H6/c1-5-7-13(6-2)16(18)15-10-14-9-11(3)8-12(4)17(14)19-15;2*1-2/h5-10,16,18H,1-2H2,3-4H3;2*1-2H3/b13-7+;; |
| InChIKey | QNTNCWOTEIYFSY-JOZOFPPJSA-N |
| XLogP | 6.43 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-1-(5,7-dimethyl-1-benzofuran-2-yl)-2-ethenylpenta-2,4-dien-1-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-1-(5,7-dimethyl-1-benzofuran-2-yl)-2-ethenylpenta-2,4-dien-1-ol;ethane?
The IUPAC name of (2E)-1-(5,7-dimethyl-1-benzofuran-2-yl)-2-ethenylpenta-2,4-dien-1-ol;ethane (CID 156724796) is (2E)-1-(5,7-dimethyl-1-benzofuran-2-yl)-2-ethenylpenta-2,4-dien-1-ol;ethane.
What is the SMILES notation for (2E)-1-(5,7-dimethyl-1-benzofuran-2-yl)-2-ethenylpenta-2,4-dien-1-ol;ethane?
The canonical SMILES for (2E)-1-(5,7-dimethyl-1-benzofuran-2-yl)-2-ethenylpenta-2,4-dien-1-ol;ethane is C=C/C=C(\C=C)C(O)c1cc2cc(C)cc(C)c2o1.CC.CC.
What is the InChIKey of (2E)-1-(5,7-dimethyl-1-benzofuran-2-yl)-2-ethenylpenta-2,4-dien-1-ol;ethane?
The InChIKey is QNTNCWOTEIYFSY-JOZOFPPJSA-N. The full InChI is InChI=1S/C17H18O2.2C2H6/c1-5-7-13(6-2)16(18)15-10-14-9-11(3)8-12(4)17(14)19-15;2*1-2/h5-10,16,18H,1-2H2,3-4H3;2*1-2H3/b13-7+;;.
What are the key properties of (2E)-1-(5,7-dimethyl-1-benzofuran-2-yl)-2-ethenylpenta-2,4-dien-1-ol;ethane?
(2E)-1-(5,7-dimethyl-1-benzofuran-2-yl)-2-ethenylpenta-2,4-dien-1-ol;ethane has a molecular weight of 314.47 g/mol, XLogP of 6.43, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-1-(5,7-dimethyl-1-benzofuran-2-yl)-2-ethenylpenta-2,4-dien-1-ol;ethane is sourced from PubChem (CID 156724796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).