C14H14O — CID 123553772
2,3-bis(ethenyl)-5,7-dimethyl-1-benzofuran (PubChem CID 123553772) has the molecular formula C14H14O and a molecular weight of 198.26 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-5,7-dimethyl-1-benzofuran.
| Compound Name | 2,3-bis(ethenyl)-5,7-dimethyl-1-benzofuran |
|---|---|
| PubChem CID | 123553772 |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 2,3-bis(ethenyl)-5,7-dimethyl-1-benzofuran |
| SMILES | C=Cc1oc2c(C)cc(C)cc2c1C=C |
| InChI | InChI=1S/C14H14O/c1-5-11-12-8-9(3)7-10(4)14(12)15-13(11)6-2/h5-8H,1-2H2,3-4H3 |
| InChIKey | FVZKFCIFCVNEPU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |