C17H20 — CID 143776422
1-ethenyl-5,7-dimethyl-2-propylnaphthalene (PubChem CID 143776422) has the molecular formula C17H20 and a molecular weight of 224.35 g/mol. Its IUPAC name is 1-ethenyl-5,7-dimethyl-2-propylnaphthalene.
| Compound Name | 1-ethenyl-5,7-dimethyl-2-propylnaphthalene |
|---|---|
| PubChem CID | 143776422 |
| Molecular Formula | C17H20 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 1-ethenyl-5,7-dimethyl-2-propylnaphthalene |
| SMILES | C=Cc1c(CCC)ccc2c(C)cc(C)cc12 |
| InChI | InChI=1S/C17H20/c1-5-7-14-8-9-16-13(4)10-12(3)11-17(16)15(14)6-2/h6,8-11H,2,5,7H2,1,3-4H3 |
| InChIKey | TVMRKQHEOBCEAO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |