C15H18 — CID 57064883
1,3-dimethyl-5-propylnaphthalene (PubChem CID 57064883) has the molecular formula C15H18 and a molecular weight of 198.31 g/mol. Its IUPAC name is 1,3-dimethyl-5-propylnaphthalene.
| Compound Name | 1,3-dimethyl-5-propylnaphthalene |
|---|---|
| PubChem CID | 57064883 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 1,3-dimethyl-5-propylnaphthalene |
| SMILES | CCCc1cccc2c(C)cc(C)cc12 |
| InChI | InChI=1S/C15H18/c1-4-6-13-7-5-8-14-12(3)9-11(2)10-15(13)14/h5,7-10H,4,6H2,1-3H3 |
| InChIKey | BDPHTRCHOXHLAM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |