C19H22O2 — CID 57337591
(1R,2R)-1-(1-ethenyl-4,7-dimethylnaphthalen-2-yl)-2-methoxybut-3-en-1-ol (PubChem CID 57337591) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is (1R,2R)-1-(1-ethenyl-4,7-dimethylnaphthalen-2-yl)-2-methoxybut-3-en-1-ol.
| Compound Name | (1R,2R)-1-(1-ethenyl-4,7-dimethylnaphthalen-2-yl)-2-methoxybut-3-en-1-ol |
|---|---|
| PubChem CID | 57337591 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | (1R,2R)-1-(1-ethenyl-4,7-dimethylnaphthalen-2-yl)-2-methoxybut-3-en-1-ol |
| SMILES | C=Cc1c([C@@H](O)[C@@H](C=C)OC)cc(C)c2ccc(C)cc12 |
| InChI | InChI=1S/C19H22O2/c1-6-14-16-10-12(3)8-9-15(16)13(4)11-17(14)19(20)18(7-2)21-5/h6-11,18-20H,1-2H2,3-5H3/t18-,19-/m1/s1 |
| InChIKey | XVXSBUUVFHNLKO-RTBURBONSA-N |
| XLogP | 4.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|