C18H26O — CID 142061376
2,3-bis(ethenyl)-6-ethyl-1-benzofuran;ethane (PubChem CID 142061376) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-6-ethyl-1-benzofuran;ethane.
| Compound Name | 2,3-bis(ethenyl)-6-ethyl-1-benzofuran;ethane |
|---|---|
| PubChem CID | 142061376 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 2,3-bis(ethenyl)-6-ethyl-1-benzofuran;ethane |
| SMILES | C=Cc1oc2cc(CC)ccc2c1C=C.CC.CC |
| InChI | InChI=1S/C14H14O.2C2H6/c1-4-10-7-8-12-11(5-2)13(6-3)15-14(12)9-10;2*1-2/h5-9H,2-4H2,1H3;2*1-2H3 |
| InChIKey | OUURDGSECSOSCJ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |