C20H20O — CID 145452303
2-ethenyl-6-(4-methylphenyl)-3-propyl-1-benzofuran (PubChem CID 145452303) has the molecular formula C20H20O and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-ethenyl-6-(4-methylphenyl)-3-propyl-1-benzofuran.
| Compound Name | 2-ethenyl-6-(4-methylphenyl)-3-propyl-1-benzofuran |
|---|---|
| PubChem CID | 145452303 |
| Molecular Formula | C20H20O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2-ethenyl-6-(4-methylphenyl)-3-propyl-1-benzofuran |
| SMILES | C=Cc1oc2cc(-c3ccc(C)cc3)ccc2c1CCC |
| InChI | InChI=1S/C20H20O/c1-4-6-17-18-12-11-16(13-20(18)21-19(17)5-2)15-9-7-14(3)8-10-15/h5,7-13H,2,4,6H2,1,3H3 |
| InChIKey | KEWSZDKVOBCZEM-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |