C13H10O2 — CID 144768178
2,3-bis(ethenyl)-1-benzofuran-6-carbaldehyde (PubChem CID 144768178) has the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-1-benzofuran-6-carbaldehyde.
| Compound Name | 2,3-bis(ethenyl)-1-benzofuran-6-carbaldehyde |
|---|---|
| PubChem CID | 144768178 |
| Molecular Formula | C13H10O2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 2,3-bis(ethenyl)-1-benzofuran-6-carbaldehyde |
| SMILES | C=Cc1oc2cc(C=O)ccc2c1C=C |
| InChI | InChI=1S/C13H10O2/c1-3-10-11-6-5-9(8-14)7-13(11)15-12(10)4-2/h3-8H,1-2H2 |
| InChIKey | FSCZHXNJPPFKED-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|