C16H13NO — CID 170257473
1-(2-ethenylbenzo[f][1]benzofuran-3-yl)-N-methylmethanimine (PubChem CID 170257473) has the molecular formula C16H13NO and a molecular weight of 235.29 g/mol. Its IUPAC name is 1-(2-ethenylbenzo[f][1]benzofuran-3-yl)-N-methylmethanimine.
| Compound Name | 1-(2-ethenylbenzo[f][1]benzofuran-3-yl)-N-methylmethanimine |
|---|---|
| PubChem CID | 170257473 |
| Molecular Formula | C16H13NO |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 1-(2-ethenylbenzo[f][1]benzofuran-3-yl)-N-methylmethanimine |
| SMILES | C=Cc1oc2cc3ccccc3cc2c1/C=N/C |
| InChI | InChI=1S/C16H13NO/c1-3-15-14(10-17-2)13-8-11-6-4-5-7-12(11)9-16(13)18-15/h3-10H,1H2,2H3/b17-10+ |
| InChIKey | JQGCTMCHYASJNG-LICLKQGHSA-N |
| XLogP | 4.28 |
| TPSA | 25.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|