C16H16O — CID 135251716
1,7-diethyldibenzofuran (PubChem CID 135251716) has the molecular formula C16H16O and a molecular weight of 224.30 g/mol. Its IUPAC name is 1,7-diethyldibenzofuran.
| Compound Name | 1,7-diethyldibenzofuran |
|---|---|
| PubChem CID | 135251716 |
| Molecular Formula | C16H16O |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 1,7-diethyldibenzofuran |
| SMILES | CCc1ccc2c(c1)oc1cccc(CC)c12 |
| InChI | InChI=1S/C16H16O/c1-3-11-8-9-13-15(10-11)17-14-7-5-6-12(4-2)16(13)14/h5-10H,3-4H2,1-2H3 |
| InChIKey | MUCSZRMAZRNLCY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |