C12H14O — CID 121007664
4-ethyl-2,3-dimethyl-1-benzofuran (PubChem CID 121007664) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is 4-ethyl-2,3-dimethyl-1-benzofuran.
| Compound Name | 4-ethyl-2,3-dimethyl-1-benzofuran |
|---|---|
| PubChem CID | 121007664 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 4-ethyl-2,3-dimethyl-1-benzofuran |
| SMILES | CCc1cccc2oc(C)c(C)c12 |
| InChI | InChI=1S/C12H14O/c1-4-10-6-5-7-11-12(10)8(2)9(3)13-11/h5-7H,4H2,1-3H3 |
| InChIKey | ULHVRNSKAPGWIV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |