C13H13BrO2 — CID 145057358
3-bromo-2,5-diethylchromen-4-one (PubChem CID 145057358) has the molecular formula C13H13BrO2 and a molecular weight of 281.15 g/mol. Its IUPAC name is 3-bromo-2,5-diethylchromen-4-one.
| Compound Name | 3-bromo-2,5-diethylchromen-4-one |
|---|---|
| PubChem CID | 145057358 |
| Molecular Formula | C13H13BrO2 |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 3-bromo-2,5-diethylchromen-4-one |
| SMILES | CCc1oc2cccc(CC)c2c(=O)c1Br |
| InChI | InChI=1S/C13H13BrO2/c1-3-8-6-5-7-10-11(8)13(15)12(14)9(4-2)16-10/h5-7H,3-4H2,1-2H3 |
| InChIKey | RYODSPYFXDGCBN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |