C11H14BrN — CID 174727247
2-bromo-1,3-diethylbenzene;formonitrile (PubChem CID 174727247) has the molecular formula C11H14BrN and a molecular weight of 240.14 g/mol. Its IUPAC name is 2-bromo-1,3-diethylbenzene;formonitrile.
| Compound Name | 2-bromo-1,3-diethylbenzene;formonitrile |
|---|---|
| PubChem CID | 174727247 |
| Molecular Formula | C11H14BrN |
| Molecular Weight | 240.14 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 2-bromo-1,3-diethylbenzene;formonitrile |
| SMILES | C#N.CCc1cccc(CC)c1Br |
| InChI | InChI=1S/C10H13Br.CHN/c1-3-8-6-5-7-9(4-2)10(8)11;1-2/h5-7H,3-4H2,1-2H3;1H |
| InChIKey | VNYVMSDDGZOUFE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.14 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |