C13H17N — CID 118253289
4-ethyl-1,2,3-trimethylindole (PubChem CID 118253289) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 4-ethyl-1,2,3-trimethylindole.
| Compound Name | 4-ethyl-1,2,3-trimethylindole |
|---|---|
| PubChem CID | 118253289 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 4-ethyl-1,2,3-trimethylindole |
| SMILES | CCc1cccc2c1c(C)c(C)n2C |
| InChI | InChI=1S/C13H17N/c1-5-11-7-6-8-12-13(11)9(2)10(3)14(12)4/h6-8H,5H2,1-4H3 |
| InChIKey | YSLYMFFPMWREBW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |