C15H16N2O — CID 115043759
1-ethyl-5,9-dimethyl-2H-pyrido[3,4-b]indol-3-one (PubChem CID 115043759) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is 1-ethyl-5,9-dimethyl-2H-pyrido[3,4-b]indol-3-one.
| Compound Name | 1-ethyl-5,9-dimethyl-2H-pyrido[3,4-b]indol-3-one |
|---|---|
| PubChem CID | 115043759 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 1-ethyl-5,9-dimethyl-2H-pyrido[3,4-b]indol-3-one |
| SMILES | CCc1[nH]c(=O)cc2c3c(C)cccc3n(C)c12 |
| InChI | InChI=1S/C15H16N2O/c1-4-11-15-10(8-13(18)16-11)14-9(2)6-5-7-12(14)17(15)3/h5-8H,4H2,1-3H3,(H,16,18) |
| InChIKey | GNBHCYAXZULOJL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |