C13H11FN2O — CID 115037629
1-ethyl-8-fluoro-2,9-dihydropyrido[3,4-b]indol-3-one (PubChem CID 115037629) has the molecular formula C13H11FN2O and a molecular weight of 230.24 g/mol. Its IUPAC name is 1-ethyl-8-fluoro-2,9-dihydropyrido[3,4-b]indol-3-one.
| Compound Name | 1-ethyl-8-fluoro-2,9-dihydropyrido[3,4-b]indol-3-one |
|---|---|
| PubChem CID | 115037629 |
| Molecular Formula | C13H11FN2O |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 1-ethyl-8-fluoro-2,9-dihydropyrido[3,4-b]indol-3-one |
| SMILES | CCc1[nH]c(=O)cc2c1[nH]c1c(F)cccc12 |
| InChI | InChI=1S/C13H11FN2O/c1-2-10-13-8(6-11(17)15-10)7-4-3-5-9(14)12(7)16-13/h3-6,16H,2H2,1H3,(H,15,17) |
| InChIKey | STEZDVZYTJEMBE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |