C11H10FNO2 — CID 84674927
2-ethyl-7-fluoro-1H-indole-3-carboxylic acid (PubChem CID 84674927) has the molecular formula C11H10FNO2 and a molecular weight of 207.20 g/mol. Its IUPAC name is 2-ethyl-7-fluoro-1H-indole-3-carboxylic acid.
| Compound Name | 2-ethyl-7-fluoro-1H-indole-3-carboxylic acid |
|---|---|
| PubChem CID | 84674927 |
| Molecular Formula | C11H10FNO2 |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 2-ethyl-7-fluoro-1H-indole-3-carboxylic acid |
| SMILES | CCc1[nH]c2c(F)cccc2c1C(=O)O |
| InChI | InChI=1S/C11H10FNO2/c1-2-8-9(11(14)15)6-4-3-5-7(12)10(6)13-8/h3-5,13H,2H2,1H3,(H,14,15) |
| InChIKey | VVUXQBOBEWFPQY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |