C15H16N2O — CID 115043749
8-methyl-1-propyl-2,9-dihydropyrido[3,4-b]indol-3-one (PubChem CID 115043749) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is 8-methyl-1-propyl-2,9-dihydropyrido[3,4-b]indol-3-one.
| Compound Name | 8-methyl-1-propyl-2,9-dihydropyrido[3,4-b]indol-3-one |
|---|---|
| PubChem CID | 115043749 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 8-methyl-1-propyl-2,9-dihydropyrido[3,4-b]indol-3-one |
| SMILES | CCCc1[nH]c(=O)cc2c1[nH]c1c(C)cccc12 |
| InChI | InChI=1S/C15H16N2O/c1-3-5-12-15-11(8-13(18)16-12)10-7-4-6-9(2)14(10)17-15/h4,6-8,17H,3,5H2,1-2H3,(H,16,18) |
| InChIKey | DEFIBXQBFBDSLY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |