C29H15NO4 — CID 19431832
7-methyl-9-azaheptacyclo[19.8.0.02,10.03,8.011,20.013,18.023,28]nonacosa-1,3,5,7,10,13,15,17,20,23,25,27-dodecaene-12,19,22,29-tetrone (PubChem CID 19431832) has the molecular formula C29H15NO4 and a molecular weight of 441.44 g/mol. Its IUPAC name is 7-methyl-9-azaheptacyclo[19.8.0.02,10.03,8.011,20.013,18.023,28]nonacosa-1,3,5,7,10,13,15,17,20,23,25,27-dodecaene-12,19,22,29-tetrone.
| Compound Name | 7-methyl-9-azaheptacyclo[19.8.0.02,10.03,8.011,20.013,18.023,28]nonacosa-1,3,5,7,10,13,15,17,20,23,25,27-dodecaene-12,19,22,29-tetrone |
|---|---|
| PubChem CID | 19431832 |
| Molecular Formula | C29H15NO4 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 7-methyl-9-azaheptacyclo[19.8.0.02,10.03,8.011,20.013,18.023,28]nonacosa-1,3,5,7,10,13,15,17,20,23,25,27-dodecaene-12,19,22,29-tetrone |
| SMILES | Cc1cccc2c1[nH]c1c3c(=O)c4ccccc4c(=O)c3c3c(=O)c4ccccc4c(=O)c3c21 |
| InChI | InChI=1S/C29H15NO4/c1-13-7-6-12-18-19-20-21(27(32)15-9-3-2-8-14(15)26(20)31)22-23(25(19)30-24(13)18)29(34)17-11-5-4-10-16(17)28(22)33/h2-12,30H,1H3 |
| InChIKey | BUMQDFUUVJGZHD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 84.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|