C14H19N — CID 59397804
2-tert-butyl-3,7-dimethyl-1H-indole (PubChem CID 59397804) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-tert-butyl-3,7-dimethyl-1H-indole.
| Compound Name | 2-tert-butyl-3,7-dimethyl-1H-indole |
|---|---|
| PubChem CID | 59397804 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2-tert-butyl-3,7-dimethyl-1H-indole |
| SMILES | Cc1c(C(C)(C)C)[nH]c2c(C)cccc12 |
| InChI | InChI=1S/C14H19N/c1-9-7-6-8-11-10(2)13(14(3,4)5)15-12(9)11/h6-8,15H,1-5H3 |
| InChIKey | MYOLLFUNPRNHLV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |