C12H13NO — CID 112710904
2-(3,7-dimethyl-1H-indol-2-yl)acetaldehyde (PubChem CID 112710904) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-(3,7-dimethyl-1H-indol-2-yl)acetaldehyde.
| Compound Name | 2-(3,7-dimethyl-1H-indol-2-yl)acetaldehyde |
|---|---|
| PubChem CID | 112710904 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 2-(3,7-dimethyl-1H-indol-2-yl)acetaldehyde |
| SMILES | Cc1c(CC=O)[nH]c2c(C)cccc12 |
| InChI | InChI=1S/C12H13NO/c1-8-4-3-5-10-9(2)11(6-7-14)13-12(8)10/h3-5,7,13H,6H2,1-2H3 |
| InChIKey | MVNRBPJBERIZMD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|