C13H17NO2 — CID 145321259
3,7-dimethyl-1H-indole-2-carboxylic acid;ethane (PubChem CID 145321259) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 3,7-dimethyl-1H-indole-2-carboxylic acid;ethane.
| Compound Name | 3,7-dimethyl-1H-indole-2-carboxylic acid;ethane |
|---|---|
| PubChem CID | 145321259 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 3,7-dimethyl-1H-indole-2-carboxylic acid;ethane |
| SMILES | CC.Cc1c(C(=O)O)[nH]c2c(C)cccc12 |
| InChI | InChI=1S/C11H11NO2.C2H6/c1-6-4-3-5-8-7(2)10(11(13)14)12-9(6)8;1-2/h3-5,12H,1-2H3,(H,13,14);1-2H3 |
| InChIKey | LHMRGEPHRFDMJF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|