C11H11NS — CID 2118128
4,8-dimethyl-1H-quinoline-2-thione (PubChem CID 2118128) has the molecular formula C11H11NS and a molecular weight of 189.28 g/mol. Its IUPAC name is 4,8-dimethyl-1H-quinoline-2-thione.
| Compound Name | 4,8-dimethyl-1H-quinoline-2-thione |
|---|---|
| PubChem CID | 2118128 |
| Molecular Formula | C11H11NS |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 4,8-dimethyl-1H-quinoline-2-thione |
| SMILES | Cc1cc(=S)[nH]c2c(C)cccc12 |
| InChI | InChI=1S/C11H11NS/c1-7-4-3-5-9-8(2)6-10(13)12-11(7)9/h3-6H,1-2H3,(H,12,13) |
| InChIKey | IDKGGDCCFSDICC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|