C29H17N3O6 — CID 11202896
9,17,27-trimethyl-9,14,24-triazaheptacyclo[19.8.0.02,10.03,8.011,20.013,18.023,28]nonacosa-1,3,5,7,10,13(18),16,20,23(28),26-decaene-12,15,19,22,25,29-hexone (PubChem CID 11202896) has the molecular formula C29H17N3O6 and a molecular weight of 503.47 g/mol. Its IUPAC name is 9,17,27-trimethyl-9,14,24-triazaheptacyclo[19.8.0.02,10.03,8.011,20.013,18.023,28]nonacosa-1,3,5,7,10,13(18),16,20,23(28),26-decaene-12,15,19,22,25,29-hexone.
| Compound Name | 9,17,27-trimethyl-9,14,24-triazaheptacyclo[19.8.0.02,10.03,8.011,20.013,18.023,28]nonacosa-1,3,5,7,10,13(18),16,20,23(28),26-decaene-12,15,19,22,25,29-hexone |
|---|---|
| PubChem CID | 11202896 |
| Molecular Formula | C29H17N3O6 |
| Molecular Weight | 503.47 g/mol |
| Exact Mass | 503.11 |
| IUPAC Name | 9,17,27-trimethyl-9,14,24-triazaheptacyclo[19.8.0.02,10.03,8.011,20.013,18.023,28]nonacosa-1,3,5,7,10,13(18),16,20,23(28),26-decaene-12,15,19,22,25,29-hexone |
| SMILES | Cc1cc(=O)[nH]c2c(=O)c3c(c(=O)c12)c1c(=O)c2[nH]c(=O)cc(C)c2c(=O)c1c1c2ccccc2n(C)c31 |
| InChI | InChI=1S/C29H17N3O6/c1-10-8-14(33)30-23-16(10)26(35)19-18-12-6-4-5-7-13(12)32(3)25(18)22-21(20(19)28(23)37)27(36)17-11(2)9-15(34)31-24(17)29(22)38/h4-9H,1-3H3,(H,30,33)(H,31,34) |
| InChIKey | GUDILYABSVLQJN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 138.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|