C13H11NO — CID 143904275
5-ethyl-[1]benzofuro[2,3-b]pyridine (PubChem CID 143904275) has the molecular formula C13H11NO and a molecular weight of 197.24 g/mol. Its IUPAC name is 5-ethyl-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 5-ethyl-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 143904275 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 5-ethyl-[1]benzofuro[2,3-b]pyridine |
| SMILES | CCc1cccc2oc3ncccc3c12 |
| InChI | InChI=1S/C13H11NO/c1-2-9-5-3-7-11-12(9)10-6-4-8-14-13(10)15-11/h3-8H,2H2,1H3 |
| InChIKey | WNDDETCCJMAGGX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |