C14H13NO — CID 139383057
5-propan-2-yl-[1]benzofuro[2,3-b]pyridine (PubChem CID 139383057) has the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. Its IUPAC name is 5-propan-2-yl-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 5-propan-2-yl-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 139383057 |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 5-propan-2-yl-[1]benzofuro[2,3-b]pyridine |
| SMILES | CC(C)c1cccc2oc3ncccc3c12 |
| InChI | InChI=1S/C14H13NO/c1-9(2)10-5-3-7-12-13(10)11-6-4-8-15-14(11)16-12/h3-9H,1-2H3 |
| InChIKey | NVIBBNCRURZXGH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |