C14H23NO — CID 142876964
ethane;2-ethyl-3-methylfuro[2,3-b]pyridine (PubChem CID 142876964) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is ethane;2-ethyl-3-methylfuro[2,3-b]pyridine.
| Compound Name | ethane;2-ethyl-3-methylfuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 142876964 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | ethane;2-ethyl-3-methylfuro[2,3-b]pyridine |
| SMILES | CC.CC.CCc1oc2ncccc2c1C |
| InChI | InChI=1S/C10H11NO.2C2H6/c1-3-9-7(2)8-5-4-6-11-10(8)12-9;2*1-2/h4-6H,3H2,1-2H3;2*1-2H3 |
| InChIKey | WMLSTBOYQMQWNM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |